C23H21ClN2O — CID 5474823
(7E)-7-[(2Z)-2-(5-chloro-1,3,3-trimethylindol-2-ylidene)ethylidene]-5-methylquinolin-8-one (PubChem CID 5474823) has the molecular formula C23H21ClN2O and a molecular weight of 376.89 g/mol. Its IUPAC name is (7E)-7-[(2Z)-2-(5-chloro-1,3,3-trimethylindol-2-ylidene)ethylidene]-5-methylquinolin-8-one.
| Compound Name | (7E)-7-[(2Z)-2-(5-chloro-1,3,3-trimethylindol-2-ylidene)ethylidene]-5-methylquinolin-8-one |
|---|---|
| PubChem CID | 5474823 |
| Molecular Formula | C23H21ClN2O |
| Molecular Weight | 376.89 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | (7E)-7-[(2Z)-2-(5-chloro-1,3,3-trimethylindol-2-ylidene)ethylidene]-5-methylquinolin-8-one |
| SMILES | CC1=C/C(=C\C=C2/N(C)c3ccc(Cl)cc3C2(C)C)C(=O)c2ncccc21 |
| InChI | InChI=1S/C23H21ClN2O/c1-14-12-15(22(27)21-17(14)6-5-11-25-21)7-10-20-23(2,3)18-13-16(24)8-9-19(18)26(20)4/h5-13H,1-4H3/b15-7+,20-10- |
| InChIKey | UTLUHPCHKAEJOI-JRTLMRLOSA-N |
| XLogP | 5.57 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.89 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|