C23H22N2O6S — CID 171376897
(7E)-7-[(2Z)-2-(8-hydroxy-1-methylquinolin-2-ylidene)ethylidene]-5-methylquinolin-8-one;methyl hydrogen sulfate (PubChem CID 171376897) has the molecular formula C23H22N2O6S and a molecular weight of 454.50 g/mol. Its IUPAC name is (7E)-7-[(2Z)-2-(8-hydroxy-1-methylquinolin-2-ylidene)ethylidene]-5-methylquinolin-8-one;methyl hydrogen sulfate.
| Compound Name | (7E)-7-[(2Z)-2-(8-hydroxy-1-methylquinolin-2-ylidene)ethylidene]-5-methylquinolin-8-one;methyl hydrogen sulfate |
|---|---|
| PubChem CID | 171376897 |
| Molecular Formula | C23H22N2O6S |
| Molecular Weight | 454.50 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | (7E)-7-[(2Z)-2-(8-hydroxy-1-methylquinolin-2-ylidene)ethylidene]-5-methylquinolin-8-one;methyl hydrogen sulfate |
| SMILES | CC1=C/C(=C\C=C2\C=Cc3cccc(O)c3N2C)C(=O)c2ncccc21.COS(=O)(=O)O |
| InChI | InChI=1S/C22H18N2O2.CH4O4S/c1-14-13-16(22(26)20-18(14)6-4-12-23-20)9-11-17-10-8-15-5-3-7-19(25)21(15)24(17)2;1-5-6(2,3)4/h3-13,25H,1-2H3;1H3,(H,2,3,4)/b16-9+,17-11-; |
| InChIKey | LKTPAQRLZVDDHV-GLLSOQDISA-N |
| XLogP | 3.80 |
| TPSA | 117.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.50 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|