C19H19NO6S — CID 171376862
(6E)-6-[(2E)-2-(8-hydroxy-1-methylquinolin-2-ylidene)ethylidene]cyclohexa-2,4-dien-1-one;methyl hydrogen sulfate (PubChem CID 171376862) has the molecular formula C19H19NO6S and a molecular weight of 389.43 g/mol. Its IUPAC name is (6E)-6-[(2E)-2-(8-hydroxy-1-methylquinolin-2-ylidene)ethylidene]cyclohexa-2,4-dien-1-one;methyl hydrogen sulfate.
| Compound Name | (6E)-6-[(2E)-2-(8-hydroxy-1-methylquinolin-2-ylidene)ethylidene]cyclohexa-2,4-dien-1-one;methyl hydrogen sulfate |
|---|---|
| PubChem CID | 171376862 |
| Molecular Formula | C19H19NO6S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | (6E)-6-[(2E)-2-(8-hydroxy-1-methylquinolin-2-ylidene)ethylidene]cyclohexa-2,4-dien-1-one;methyl hydrogen sulfate |
| SMILES | CN1/C(=C/C=C2\C=CC=CC2=O)C=Cc2cccc(O)c21.COS(=O)(=O)O |
| InChI | InChI=1S/C18H15NO2.CH4O4S/c1-19-15(11-9-13-5-2-3-7-16(13)20)12-10-14-6-4-8-17(21)18(14)19;1-5-6(2,3)4/h2-12,21H,1H3;1H3,(H,2,3,4)/b13-9+,15-11+; |
| InChIKey | UFEXKFJUHSGOMV-OOXGGUGISA-N |
| XLogP | 2.80 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|