C15H13NO4 — CID 159863525
2-[2-(1-methylquinolin-2-ylidene)ethylidene]propanedioic acid (PubChem CID 159863525) has the molecular formula C15H13NO4 and a molecular weight of 271.27 g/mol. Its IUPAC name is 2-[2-(1-methylquinolin-2-ylidene)ethylidene]propanedioic acid.
| Compound Name | 2-[2-(1-methylquinolin-2-ylidene)ethylidene]propanedioic acid |
|---|---|
| PubChem CID | 159863525 |
| Molecular Formula | C15H13NO4 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 2-[2-(1-methylquinolin-2-ylidene)ethylidene]propanedioic acid |
| SMILES | CN1C(=CC=C(C(=O)O)C(=O)O)C=Cc2ccccc21 |
| InChI | InChI=1S/C15H13NO4/c1-16-11(8-9-12(14(17)18)15(19)20)7-6-10-4-2-3-5-13(10)16/h2-9H,1H3,(H,17,18)(H,19,20) |
| InChIKey | NRLFLFAWJRAMFH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|