C26H26N2 — CID 7053751
N,N-dimethyl-4-[(1R)-2-(1-methylquinolin-2-ylidene)-1-phenylethyl]aniline (PubChem CID 7053751) has the molecular formula C26H26N2 and a molecular weight of 366.51 g/mol. Its IUPAC name is N,N-dimethyl-4-[(1R)-2-(1-methylquinolin-2-ylidene)-1-phenylethyl]aniline.
| Compound Name | N,N-dimethyl-4-[(1R)-2-(1-methylquinolin-2-ylidene)-1-phenylethyl]aniline |
|---|---|
| PubChem CID | 7053751 |
| Molecular Formula | C26H26N2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | N,N-dimethyl-4-[(1R)-2-(1-methylquinolin-2-ylidene)-1-phenylethyl]aniline |
| SMILES | CN(C)c1ccc([C@H](C=C2C=Cc3ccccc3N2C)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H26N2/c1-27(2)23-16-13-21(14-17-23)25(20-9-5-4-6-10-20)19-24-18-15-22-11-7-8-12-26(22)28(24)3/h4-19,25H,1-3H3/t25-/m1/s1 |
| InChIKey | DMFRMHILNMGLRN-RUZDIDTESA-N |
| XLogP | 5.93 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|