C25H24N2 — CID 7053748
N,N-dimethyl-4-[(1S,2E)-1-phenyl-2-(1H-quinolin-2-ylidene)ethyl]aniline (PubChem CID 7053748) has the molecular formula C25H24N2 and a molecular weight of 352.48 g/mol. Its IUPAC name is N,N-dimethyl-4-[(1S,2E)-1-phenyl-2-(1H-quinolin-2-ylidene)ethyl]aniline.
| Compound Name | N,N-dimethyl-4-[(1S,2E)-1-phenyl-2-(1H-quinolin-2-ylidene)ethyl]aniline |
|---|---|
| PubChem CID | 7053748 |
| Molecular Formula | C25H24N2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | N,N-dimethyl-4-[(1S,2E)-1-phenyl-2-(1H-quinolin-2-ylidene)ethyl]aniline |
| SMILES | CN(C)c1ccc([C@@H](/C=C2\C=Cc3ccccc3N2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H24N2/c1-27(2)23-16-13-20(14-17-23)24(19-8-4-3-5-9-19)18-22-15-12-21-10-6-7-11-25(21)26-22/h3-18,24,26H,1-2H3/b22-18+/t24-/m0/s1 |
| InChIKey | MIKIJJDATHBDEV-HCYCUYITSA-N |
| XLogP | 5.91 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|