C16H20N2OS — CID 154734832
methyl N-(3-hydroxypropyl)-2-(1-methylquinolin-2-ylidene)ethanimidothioate (PubChem CID 154734832) has the molecular formula C16H20N2OS and a molecular weight of 288.42 g/mol. Its IUPAC name is methyl N-(3-hydroxypropyl)-2-(1-methylquinolin-2-ylidene)ethanimidothioate.
| Compound Name | methyl N-(3-hydroxypropyl)-2-(1-methylquinolin-2-ylidene)ethanimidothioate |
|---|---|
| PubChem CID | 154734832 |
| Molecular Formula | C16H20N2OS |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | methyl N-(3-hydroxypropyl)-2-(1-methylquinolin-2-ylidene)ethanimidothioate |
| SMILES | CS/C(C=C1C=Cc2ccccc2N1C)=N\CCCO |
| InChI | InChI=1S/C16H20N2OS/c1-18-14(12-16(20-2)17-10-5-11-19)9-8-13-6-3-4-7-15(13)18/h3-4,6-9,12,19H,5,10-11H2,1-2H3/b14-12?,17-16- |
| InChIKey | YBIXHWVOFVVNLN-AOQLEIMZSA-N |
| XLogP | 3.18 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|