C23H19ClN2O4 — CID 88804086
(2E)-1-methyl-2-[3-(1-methylquinolin-1-ium-2-yl)prop-2-ynylidene]quinoline perchlorate (PubChem CID 88804086) has the molecular formula C23H19ClN2O4 and a molecular weight of 422.87 g/mol. Its IUPAC name is (2E)-1-methyl-2-[3-(1-methylquinolin-1-ium-2-yl)prop-2-ynylidene]quinoline perchlorate.
| Compound Name | (2E)-1-methyl-2-[3-(1-methylquinolin-1-ium-2-yl)prop-2-ynylidene]quinoline perchlorate |
|---|---|
| PubChem CID | 88804086 |
| Molecular Formula | C23H19ClN2O4 |
| Molecular Weight | 422.87 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | (2E)-1-methyl-2-[3-(1-methylquinolin-1-ium-2-yl)prop-2-ynylidene]quinoline perchlorate |
| SMILES | CN1/C(=C/C#Cc2ccc3ccccc3[n+]2C)C=Cc2ccccc21.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C23H19N2.ClHO4/c1-24-20(16-14-18-8-3-5-12-22(18)24)10-7-11-21-17-15-19-9-4-6-13-23(19)25(21)2;2-1(3,4)5/h3-6,8-10,12-17H,1-2H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | CKOQXDSPIYCMHI-UHFFFAOYSA-M |
| XLogP | -0.69 |
| TPSA | 99.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.87 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|