C23H23N — CID 134413065
(2E)-2-[(Z)-4-(2,5-dimethylphenyl)-2-methylidenebut-3-enylidene]-1-methylquinoline (PubChem CID 134413065) has the molecular formula C23H23N and a molecular weight of 313.44 g/mol. Its IUPAC name is (2E)-2-[(Z)-4-(2,5-dimethylphenyl)-2-methylidenebut-3-enylidene]-1-methylquinoline.
| Compound Name | (2E)-2-[(Z)-4-(2,5-dimethylphenyl)-2-methylidenebut-3-enylidene]-1-methylquinoline |
|---|---|
| PubChem CID | 134413065 |
| Molecular Formula | C23H23N |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | (2E)-2-[(Z)-4-(2,5-dimethylphenyl)-2-methylidenebut-3-enylidene]-1-methylquinoline |
| SMILES | C=C(/C=C\c1cc(C)ccc1C)/C=C1\C=Cc2ccccc2N1C |
| InChI | InChI=1S/C23H23N/c1-17-9-11-19(3)21(15-17)12-10-18(2)16-22-14-13-20-7-5-6-8-23(20)24(22)4/h5-16H,2H2,1,3-4H3/b12-10-,22-16+ |
| InChIKey | DUPIPMIGASCBFD-PMDXQPJMSA-N |
| XLogP | 5.92 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|