C13H11NO3 — CID 22807854
(6E)-6-[(N,3-dihydroxyanilino)methylidene]cyclohexa-2,4-dien-1-one (PubChem CID 22807854) has the molecular formula C13H11NO3 and a molecular weight of 229.24 g/mol. Its IUPAC name is (6E)-6-[(N,3-dihydroxyanilino)methylidene]cyclohexa-2,4-dien-1-one.
| Compound Name | (6E)-6-[(N,3-dihydroxyanilino)methylidene]cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 22807854 |
| Molecular Formula | C13H11NO3 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | (6E)-6-[(N,3-dihydroxyanilino)methylidene]cyclohexa-2,4-dien-1-one |
| SMILES | O=C1C=CC=C/C1=C\N(O)c1cccc(O)c1 |
| InChI | InChI=1S/C13H11NO3/c15-12-6-3-5-11(8-12)14(17)9-10-4-1-2-7-13(10)16/h1-9,15,17H/b10-9+ |
| InChIKey | OYJLDQSTTDHGDC-MDZDMXLPSA-N |
| XLogP | 2.17 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|