C22H25ClN2 — CID 6437619
(2E)-1,3,3-trimethyl-2-[2-(2-methyl-2,3-dihydroindol-1-ium-1-ylidene)ethylidene]indole chloride (PubChem CID 6437619) has the molecular formula C22H25ClN2 and a molecular weight of 352.91 g/mol. Its IUPAC name is (2E)-1,3,3-trimethyl-2-[2-(2-methyl-2,3-dihydroindol-1-ium-1-ylidene)ethylidene]indole chloride.
| Compound Name | (2E)-1,3,3-trimethyl-2-[2-(2-methyl-2,3-dihydroindol-1-ium-1-ylidene)ethylidene]indole chloride |
|---|---|
| PubChem CID | 6437619 |
| Molecular Formula | C22H25ClN2 |
| Molecular Weight | 352.91 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | (2E)-1,3,3-trimethyl-2-[2-(2-methyl-2,3-dihydroindol-1-ium-1-ylidene)ethylidene]indole chloride |
| SMILES | CC1Cc2ccccc2/[N+]1=C/C=C1/N(C)c2ccccc2C1(C)C.[Cl-] |
| InChI | InChI=1S/C22H25N2.ClH/c1-16-15-17-9-5-7-11-19(17)24(16)14-13-21-22(2,3)18-10-6-8-12-20(18)23(21)4;/h5-14,16H,15H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | DSZCWNRVMXBILR-UHFFFAOYSA-M |
| XLogP | 1.66 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.91 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|