C24H29N2+ — CID 59050858
2-[1-(2-ethyl-2,3-dihydroindol-1-ium-1-ylidene)propan-2-ylidene]-1,3,3-trimethylindole (PubChem CID 59050858) has the molecular formula C24H29N2+ and a molecular weight of 345.51 g/mol. Its IUPAC name is 2-[1-(2-ethyl-2,3-dihydroindol-1-ium-1-ylidene)propan-2-ylidene]-1,3,3-trimethylindole.
| Compound Name | 2-[1-(2-ethyl-2,3-dihydroindol-1-ium-1-ylidene)propan-2-ylidene]-1,3,3-trimethylindole |
|---|---|
| PubChem CID | 59050858 |
| Molecular Formula | C24H29N2+ |
| Molecular Weight | 345.51 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | 2-[1-(2-ethyl-2,3-dihydroindol-1-ium-1-ylidene)propan-2-ylidene]-1,3,3-trimethylindole |
| SMILES | CCC1Cc2ccccc2/[N+]1=C/C(C)=C1N(C)c2ccccc2C1(C)C |
| InChI | InChI=1S/C24H29N2/c1-6-19-15-18-11-7-9-13-21(18)26(19)16-17(2)23-24(3,4)20-12-8-10-14-22(20)25(23)5/h7-14,16,19H,6,15H2,1-5H3/q+1 |
| InChIKey | TWFBBURQNVHMTM-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.51 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|