C30H38N2O2 — CID 149131412
2,4-bis[(1E)-1-(1,3,3-trimethylindol-2-ylidene)ethyl]cyclobutane-1,3-diol (PubChem CID 149131412) has the molecular formula C30H38N2O2 and a molecular weight of 458.65 g/mol. Its IUPAC name is 2,4-bis[(1E)-1-(1,3,3-trimethylindol-2-ylidene)ethyl]cyclobutane-1,3-diol.
| Compound Name | 2,4-bis[(1E)-1-(1,3,3-trimethylindol-2-ylidene)ethyl]cyclobutane-1,3-diol |
|---|---|
| PubChem CID | 149131412 |
| Molecular Formula | C30H38N2O2 |
| Molecular Weight | 458.65 g/mol |
| Exact Mass | 458.29 |
| IUPAC Name | 2,4-bis[(1E)-1-(1,3,3-trimethylindol-2-ylidene)ethyl]cyclobutane-1,3-diol |
| SMILES | C/C(=C1\N(C)c2ccccc2C1(C)C)C1C(O)C(/C(C)=C2/N(C)c3ccccc3C2(C)C)C1O |
| InChI | InChI=1S/C30H38N2O2/c1-17(27-29(3,4)19-13-9-11-15-21(19)31(27)7)23-25(33)24(26(23)34)18(2)28-30(5,6)20-14-10-12-16-22(20)32(28)8/h9-16,23-26,33-34H,1-8H3/b27-17+,28-18+ |
| InChIKey | GDOAHNAGJSPDTG-XUIWWLCJSA-N |
| XLogP | 5.36 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.65 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |