C22H24N4O3 — CID 25156263
(E,2Z,5Z)-5-(4-hydroxy-1,3-dimethyl-2,6-dioxo-1,3-diazinan-5-ylidene)-2-(1,3,3-trimethylindol-2-ylidene)pent-3-enenitrile (PubChem CID 25156263) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is (E,2Z,5Z)-5-(4-hydroxy-1,3-dimethyl-2,6-dioxo-1,3-diazinan-5-ylidene)-2-(1,3,3-trimethylindol-2-ylidene)pent-3-enenitrile.
| Compound Name | (E,2Z,5Z)-5-(4-hydroxy-1,3-dimethyl-2,6-dioxo-1,3-diazinan-5-ylidene)-2-(1,3,3-trimethylindol-2-ylidene)pent-3-enenitrile |
|---|---|
| PubChem CID | 25156263 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | (E,2Z,5Z)-5-(4-hydroxy-1,3-dimethyl-2,6-dioxo-1,3-diazinan-5-ylidene)-2-(1,3,3-trimethylindol-2-ylidene)pent-3-enenitrile |
| SMILES | CN1C(=O)/C(=C\C=C\C(C#N)=C2\N(C)c3ccccc3C2(C)C)C(O)N(C)C1=O |
| InChI | InChI=1S/C22H24N4O3/c1-22(2)16-11-6-7-12-17(16)24(3)18(22)14(13-23)9-8-10-15-19(27)25(4)21(29)26(5)20(15)28/h6-12,19,27H,1-5H3/b9-8+,15-10-,18-14- |
| InChIKey | AXWVMNWMDAKSKU-AJLVVRSISA-N |
| XLogP | 2.52 |
| TPSA | 87.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|