C14H16N2 — CID 14170385
(2E)-2-(1,3,3-trimethylindol-2-ylidene)propanenitrile (PubChem CID 14170385) has the molecular formula C14H16N2 and a molecular weight of 212.30 g/mol. Its IUPAC name is (2E)-2-(1,3,3-trimethylindol-2-ylidene)propanenitrile.
| Compound Name | (2E)-2-(1,3,3-trimethylindol-2-ylidene)propanenitrile |
|---|---|
| PubChem CID | 14170385 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | (2E)-2-(1,3,3-trimethylindol-2-ylidene)propanenitrile |
| SMILES | C/C(C#N)=C1\N(C)c2ccccc2C1(C)C |
| InChI | InChI=1S/C14H16N2/c1-10(9-15)13-14(2,3)11-7-5-6-8-12(11)16(13)4/h5-8H,1-4H3/b13-10+ |
| InChIKey | KKYSOMSAXMFVJR-JLHYYAGUSA-N |
| XLogP | 3.21 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|