C25H21N3 — CID 44669364
2-[(2E)-2-[(2E)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]-3H-inden-1-ylidene]propanedinitrile (PubChem CID 44669364) has the molecular formula C25H21N3 and a molecular weight of 363.46 g/mol. Its IUPAC name is 2-[(2E)-2-[(2E)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]-3H-inden-1-ylidene]propanedinitrile.
| Compound Name | 2-[(2E)-2-[(2E)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]-3H-inden-1-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 44669364 |
| Molecular Formula | C25H21N3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 2-[(2E)-2-[(2E)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]-3H-inden-1-ylidene]propanedinitrile |
| SMILES | CN1/C(=C/C=C2\Cc3ccccc3C2=C(C#N)C#N)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C25H21N3/c1-25(2)21-10-6-7-11-22(21)28(3)23(25)13-12-18-14-17-8-4-5-9-20(17)24(18)19(15-26)16-27/h4-13H,14H2,1-3H3/b18-12+,23-13+ |
| InChIKey | AJJUWFYIFCDQGD-SKLSXVDLSA-N |
| XLogP | 5.28 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|