C31H30N4O — CID 139242461
2-[3-oxo-2,4-bis[(Z)-(1,3,3-trimethylindol-2-ylidene)methyl]cyclobutylidene]propanedinitrile (PubChem CID 139242461) has the molecular formula C31H30N4O and a molecular weight of 474.61 g/mol. Its IUPAC name is 2-[3-oxo-2,4-bis[(Z)-(1,3,3-trimethylindol-2-ylidene)methyl]cyclobutylidene]propanedinitrile.
| Compound Name | 2-[3-oxo-2,4-bis[(Z)-(1,3,3-trimethylindol-2-ylidene)methyl]cyclobutylidene]propanedinitrile |
|---|---|
| PubChem CID | 139242461 |
| Molecular Formula | C31H30N4O |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | 2-[3-oxo-2,4-bis[(Z)-(1,3,3-trimethylindol-2-ylidene)methyl]cyclobutylidene]propanedinitrile |
| SMILES | CN1/C(=C\C2C(=O)C(/C=C3\N(C)c4ccccc4C3(C)C)C2=C(C#N)C#N)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C31H30N4O/c1-30(2)22-11-7-9-13-24(22)34(5)26(30)15-20-28(19(17-32)18-33)21(29(20)36)16-27-31(3,4)23-12-8-10-14-25(23)35(27)6/h7-16,20-21H,1-6H3/b26-15-,27-16- |
| InChIKey | AOCODWUKMONWSM-FHOIBDKLSA-N |
| XLogP | 5.77 |
| TPSA | 71.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|