C20H20N4O3S — CID 123532083
2-(3-ethyl-1,3-benzothiazol-2-ylidene)-5-(4-hydroxy-1,3-dimethyl-2,6-dioxo-1,3-diazinan-5-ylidene)pent-3-enenitrile (PubChem CID 123532083) has the molecular formula C20H20N4O3S and a molecular weight of 396.47 g/mol. Its IUPAC name is 2-(3-ethyl-1,3-benzothiazol-2-ylidene)-5-(4-hydroxy-1,3-dimethyl-2,6-dioxo-1,3-diazinan-5-ylidene)pent-3-enenitrile.
| Compound Name | 2-(3-ethyl-1,3-benzothiazol-2-ylidene)-5-(4-hydroxy-1,3-dimethyl-2,6-dioxo-1,3-diazinan-5-ylidene)pent-3-enenitrile |
|---|---|
| PubChem CID | 123532083 |
| Molecular Formula | C20H20N4O3S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 2-(3-ethyl-1,3-benzothiazol-2-ylidene)-5-(4-hydroxy-1,3-dimethyl-2,6-dioxo-1,3-diazinan-5-ylidene)pent-3-enenitrile |
| SMILES | CCN1C(=C(C#N)C=CC=C2C(=O)N(C)C(=O)N(C)C2O)Sc2ccccc21 |
| InChI | InChI=1S/C20H20N4O3S/c1-4-24-15-10-5-6-11-16(15)28-19(24)13(12-21)8-7-9-14-17(25)22(2)20(27)23(3)18(14)26/h5-11,17,25H,4H2,1-3H3 |
| InChIKey | NMOISNKLZOVNMA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 87.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|