C18H17NOS — CID 54284151
1-(3-ethyl-1,3-benzothiazol-2-ylidene)-1-phenylpropan-2-one (PubChem CID 54284151) has the molecular formula C18H17NOS and a molecular weight of 295.41 g/mol. Its IUPAC name is 1-(3-ethyl-1,3-benzothiazol-2-ylidene)-1-phenylpropan-2-one.
| Compound Name | 1-(3-ethyl-1,3-benzothiazol-2-ylidene)-1-phenylpropan-2-one |
|---|---|
| PubChem CID | 54284151 |
| Molecular Formula | C18H17NOS |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 1-(3-ethyl-1,3-benzothiazol-2-ylidene)-1-phenylpropan-2-one |
| SMILES | CCN1C(=C(C(C)=O)c2ccccc2)Sc2ccccc21 |
| InChI | InChI=1S/C18H17NOS/c1-3-19-15-11-7-8-12-16(15)21-18(19)17(13(2)20)14-9-5-4-6-10-14/h4-12H,3H2,1-2H3 |
| InChIKey | RSXMSCRZCNMONC-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|