C14H10NO2S- — CID 6988018
2-phenothiazin-10-ylacetate (PubChem CID 6988018) has the molecular formula C14H10NO2S- and a molecular weight of 256.31 g/mol. Its IUPAC name is 2-phenothiazin-10-ylacetate.
| Compound Name | 2-phenothiazin-10-ylacetate |
|---|---|
| PubChem CID | 6988018 |
| Molecular Formula | C14H10NO2S- |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 2-phenothiazin-10-ylacetate |
| SMILES | O=C([O-])CN1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C14H11NO2S/c16-14(17)9-15-10-5-1-3-7-12(10)18-13-8-4-2-6-11(13)15/h1-8H,9H2,(H,16,17)/p-1 |
| InChIKey | QUJVFIOYSMVYGY-UHFFFAOYSA-M |
| XLogP | 2.04 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |