C19H19KN2O4S — CID 167811693
potassium 4-hydroxy-2-[(2-phenothiazin-10-ylacetyl)amino]pentanoate (PubChem CID 167811693) has the molecular formula C19H19KN2O4S and a molecular weight of 410.54 g/mol. Its IUPAC name is potassium 4-hydroxy-2-[(2-phenothiazin-10-ylacetyl)amino]pentanoate.
| Compound Name | potassium 4-hydroxy-2-[(2-phenothiazin-10-ylacetyl)amino]pentanoate |
|---|---|
| PubChem CID | 167811693 |
| Molecular Formula | C19H19KN2O4S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | potassium 4-hydroxy-2-[(2-phenothiazin-10-ylacetyl)amino]pentanoate |
| SMILES | CC(O)CC(NC(=O)CN1c2ccccc2Sc2ccccc21)C(=O)[O-].[K+] |
| InChI | InChI=1S/C19H20N2O4S.K/c1-12(22)10-13(19(24)25)20-18(23)11-21-14-6-2-4-8-16(14)26-17-9-5-3-7-15(17)21;/h2-9,12-13,22H,10-11H2,1H3,(H,20,23)(H,24,25);/q;+1/p-1 |
| InChIKey | CRPJACDGZDMBLU-UHFFFAOYSA-M |
| XLogP | -1.70 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |