C18H17ClN2O2S — CID 30997351
N-[(1S)-1-(3-chlorophenyl)ethyl]-2-(3-oxo-1,4-benzothiazin-4-yl)acetamide (PubChem CID 30997351) has the molecular formula C18H17ClN2O2S and a molecular weight of 360.87 g/mol. Its IUPAC name is N-[(1S)-1-(3-chlorophenyl)ethyl]-2-(3-oxo-1,4-benzothiazin-4-yl)acetamide.
| Compound Name | N-[(1S)-1-(3-chlorophenyl)ethyl]-2-(3-oxo-1,4-benzothiazin-4-yl)acetamide |
|---|---|
| PubChem CID | 30997351 |
| Molecular Formula | C18H17ClN2O2S |
| Molecular Weight | 360.87 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | N-[(1S)-1-(3-chlorophenyl)ethyl]-2-(3-oxo-1,4-benzothiazin-4-yl)acetamide |
| SMILES | C[C@H](NC(=O)CN1C(=O)CSc2ccccc21)c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H17ClN2O2S/c1-12(13-5-4-6-14(19)9-13)20-17(22)10-21-15-7-2-3-8-16(15)24-11-18(21)23/h2-9,12H,10-11H2,1H3,(H,20,22)/t12-/m0/s1 |
| InChIKey | RUIGEEQFGSUQBW-LBPRGKRZSA-N |
| XLogP | 3.66 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.87 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |