C20H22N2O2S — CID 7416279
4-(3-oxo-1,4-benzothiazin-4-yl)-N-[(1R)-1-phenylethyl]butanamide (PubChem CID 7416279) has the molecular formula C20H22N2O2S and a molecular weight of 354.48 g/mol. Its IUPAC name is 4-(3-oxo-1,4-benzothiazin-4-yl)-N-[(1R)-1-phenylethyl]butanamide.
| Compound Name | 4-(3-oxo-1,4-benzothiazin-4-yl)-N-[(1R)-1-phenylethyl]butanamide |
|---|---|
| PubChem CID | 7416279 |
| Molecular Formula | C20H22N2O2S |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 4-(3-oxo-1,4-benzothiazin-4-yl)-N-[(1R)-1-phenylethyl]butanamide |
| SMILES | C[C@@H](NC(=O)CCCN1C(=O)CSc2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C20H22N2O2S/c1-15(16-8-3-2-4-9-16)21-19(23)12-7-13-22-17-10-5-6-11-18(17)25-14-20(22)24/h2-6,8-11,15H,7,12-14H2,1H3,(H,21,23)/t15-/m1/s1 |
| InChIKey | NCPMDQKNGUWXJX-OAHLLOKOSA-N |
| XLogP | 3.78 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |