C15H18N2O2S — CID 42786222
N-cyclopropyl-4-(3-oxo-1,4-benzothiazin-4-yl)butanamide (PubChem CID 42786222) has the molecular formula C15H18N2O2S and a molecular weight of 290.39 g/mol. Its IUPAC name is N-cyclopropyl-4-(3-oxo-1,4-benzothiazin-4-yl)butanamide.
| Compound Name | N-cyclopropyl-4-(3-oxo-1,4-benzothiazin-4-yl)butanamide |
|---|---|
| PubChem CID | 42786222 |
| Molecular Formula | C15H18N2O2S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | N-cyclopropyl-4-(3-oxo-1,4-benzothiazin-4-yl)butanamide |
| SMILES | O=C(CCCN1C(=O)CSc2ccccc21)NC1CC1 |
| InChI | InChI=1S/C15H18N2O2S/c18-14(16-11-7-8-11)6-3-9-17-12-4-1-2-5-13(12)20-10-15(17)19/h1-2,4-5,11H,3,6-10H2,(H,16,18) |
| InChIKey | INLWZRRIXUYSEX-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |