C19H26N2O2S — CID 27667405
N-cyclooctyl-3-(3-oxo-1,4-benzothiazin-4-yl)propanamide (PubChem CID 27667405) has the molecular formula C19H26N2O2S and a molecular weight of 346.50 g/mol. Its IUPAC name is N-cyclooctyl-3-(3-oxo-1,4-benzothiazin-4-yl)propanamide.
| Compound Name | N-cyclooctyl-3-(3-oxo-1,4-benzothiazin-4-yl)propanamide |
|---|---|
| PubChem CID | 27667405 |
| Molecular Formula | C19H26N2O2S |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | N-cyclooctyl-3-(3-oxo-1,4-benzothiazin-4-yl)propanamide |
| SMILES | O=C(CCN1C(=O)CSc2ccccc21)NC1CCCCCCC1 |
| InChI | InChI=1S/C19H26N2O2S/c22-18(20-15-8-4-2-1-3-5-9-15)12-13-21-16-10-6-7-11-17(16)24-14-19(21)23/h6-7,10-11,15H,1-5,8-9,12-14H2,(H,20,22) |
| InChIKey | UOUYVVAPIUGODQ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |