C16H16N2O2S2 — CID 18196027
2-(3-oxo-1,4-benzothiazin-4-yl)-N-(1-thiophen-2-ylethyl)acetamide (PubChem CID 18196027) has the molecular formula C16H16N2O2S2 and a molecular weight of 332.45 g/mol. Its IUPAC name is 2-(3-oxo-1,4-benzothiazin-4-yl)-N-(1-thiophen-2-ylethyl)acetamide.
| Compound Name | 2-(3-oxo-1,4-benzothiazin-4-yl)-N-(1-thiophen-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 18196027 |
| Molecular Formula | C16H16N2O2S2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 2-(3-oxo-1,4-benzothiazin-4-yl)-N-(1-thiophen-2-ylethyl)acetamide |
| SMILES | CC(NC(=O)CN1C(=O)CSc2ccccc21)c1cccs1 |
| InChI | InChI=1S/C16H16N2O2S2/c1-11(13-7-4-8-21-13)17-15(19)9-18-12-5-2-3-6-14(12)22-10-16(18)20/h2-8,11H,9-10H2,1H3,(H,17,19) |
| InChIKey | JYUQHFKIOIRERW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |