C21H15Cl2N3O2S — CID 136644588
N-[(3,5-dichloro-4-hydroxyphenyl)methylideneamino]-2-phenothiazin-10-ylacetamide (PubChem CID 136644588) has the molecular formula C21H15Cl2N3O2S and a molecular weight of 444.34 g/mol. Its IUPAC name is N-[(3,5-dichloro-4-hydroxyphenyl)methylideneamino]-2-phenothiazin-10-ylacetamide.
| Compound Name | N-[(3,5-dichloro-4-hydroxyphenyl)methylideneamino]-2-phenothiazin-10-ylacetamide |
|---|---|
| PubChem CID | 136644588 |
| Molecular Formula | C21H15Cl2N3O2S |
| Molecular Weight | 444.34 g/mol |
| Exact Mass | 443.03 |
| IUPAC Name | N-[(3,5-dichloro-4-hydroxyphenyl)methylideneamino]-2-phenothiazin-10-ylacetamide |
| SMILES | O=C(CN1c2ccccc2Sc2ccccc21)NN=Cc1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C21H15Cl2N3O2S/c22-14-9-13(10-15(23)21(14)28)11-24-25-20(27)12-26-16-5-1-3-7-18(16)29-19-8-4-2-6-17(19)26/h1-11,28H,12H2,(H,25,27) |
| InChIKey | ZAPODFCMMRBFHM-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.34 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|