C20H14ClN3OS — CID 14027132
N-[(E)-benzylideneamino]-2-chlorophenothiazine-10-carboxamide (PubChem CID 14027132) has the molecular formula C20H14ClN3OS and a molecular weight of 379.87 g/mol. Its IUPAC name is N-[(E)-benzylideneamino]-2-chlorophenothiazine-10-carboxamide.
| Compound Name | N-[(E)-benzylideneamino]-2-chlorophenothiazine-10-carboxamide |
|---|---|
| PubChem CID | 14027132 |
| Molecular Formula | C20H14ClN3OS |
| Molecular Weight | 379.87 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | N-[(E)-benzylideneamino]-2-chlorophenothiazine-10-carboxamide |
| SMILES | O=C(N/N=C/c1ccccc1)N1c2ccccc2Sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C20H14ClN3OS/c21-15-10-11-19-17(12-15)24(16-8-4-5-9-18(16)26-19)20(25)23-22-13-14-6-2-1-3-7-14/h1-13H,(H,23,25)/b22-13+ |
| InChIKey | BJAYQMIAGFHXJM-LPYMAVHISA-N |
| XLogP | 5.69 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.87 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|