C21H16ClN3O3S — CID 135603447
2-chloro-N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]phenothiazine-10-carboxamide (PubChem CID 135603447) has the molecular formula C21H16ClN3O3S and a molecular weight of 425.90 g/mol. Its IUPAC name is 2-chloro-N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]phenothiazine-10-carboxamide.
| Compound Name | 2-chloro-N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]phenothiazine-10-carboxamide |
|---|---|
| PubChem CID | 135603447 |
| Molecular Formula | C21H16ClN3O3S |
| Molecular Weight | 425.90 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | 2-chloro-N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]phenothiazine-10-carboxamide |
| SMILES | COc1cc(/C=N/NC(=O)N2c3ccccc3Sc3ccc(Cl)cc32)ccc1O |
| InChI | InChI=1S/C21H16ClN3O3S/c1-28-18-10-13(6-8-17(18)26)12-23-24-21(27)25-15-4-2-3-5-19(15)29-20-9-7-14(22)11-16(20)25/h2-12,26H,1H3,(H,24,27)/b23-12+ |
| InChIKey | PIJASZLMUOZCIM-FSJBWODESA-N |
| XLogP | 5.40 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.90 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|