C17H17ClN3O2S+ — CID 8772493
[2-(2-chlorophenothiazin-10-yl)-2-oxoethyl]-[2-(methylamino)-2-oxoethyl]azanium (PubChem CID 8772493) has the molecular formula C17H17ClN3O2S+ and a molecular weight of 362.86 g/mol. Its IUPAC name is [2-(2-chlorophenothiazin-10-yl)-2-oxoethyl]-[2-(methylamino)-2-oxoethyl]azanium.
| Compound Name | [2-(2-chlorophenothiazin-10-yl)-2-oxoethyl]-[2-(methylamino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8772493 |
| Molecular Formula | C17H17ClN3O2S+ |
| Molecular Weight | 362.86 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | [2-(2-chlorophenothiazin-10-yl)-2-oxoethyl]-[2-(methylamino)-2-oxoethyl]azanium |
| SMILES | CNC(=O)C[NH2+]CC(=O)N1c2ccccc2Sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C17H16ClN3O2S/c1-19-16(22)9-20-10-17(23)21-12-4-2-3-5-14(12)24-15-7-6-11(18)8-13(15)21/h2-8,20H,9-10H2,1H3,(H,19,22)/p+1 |
| InChIKey | WSEZJNHMXLSQQG-UHFFFAOYSA-O |
| XLogP | 1.78 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.86 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |