C30H23N5OS — CID 2815351
N-[(1,3-diphenylpyrazol-4-yl)methylideneamino]-2-phenothiazin-10-ylacetamide (PubChem CID 2815351) has the molecular formula C30H23N5OS and a molecular weight of 501.62 g/mol. Its IUPAC name is N-[(1,3-diphenylpyrazol-4-yl)methylideneamino]-2-phenothiazin-10-ylacetamide.
| Compound Name | N-[(1,3-diphenylpyrazol-4-yl)methylideneamino]-2-phenothiazin-10-ylacetamide |
|---|---|
| PubChem CID | 2815351 |
| Molecular Formula | C30H23N5OS |
| Molecular Weight | 501.62 g/mol |
| Exact Mass | 501.16 |
| IUPAC Name | N-[(1,3-diphenylpyrazol-4-yl)methylideneamino]-2-phenothiazin-10-ylacetamide |
| SMILES | O=C(CN1c2ccccc2Sc2ccccc21)NN=Cc1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C30H23N5OS/c36-29(21-34-25-15-7-9-17-27(25)37-28-18-10-8-16-26(28)34)32-31-19-23-20-35(24-13-5-2-6-14-24)33-30(23)22-11-3-1-4-12-22/h1-20H,21H2,(H,32,36) |
| InChIKey | QKSWVJFMOCJMDD-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 62.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.62 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|