C40H50N4O6S2 — CID 91827206
(2R,3R)-2,3-dihydroxybutanedioic acid;bis((2R)-N,N,2-trimethyl-3-phenothiazin-10-ylpropan-1-amine) (PubChem CID 91827206) has the molecular formula C40H50N4O6S2 and a molecular weight of 747.00 g/mol. Its IUPAC name is (2R,3R)-2,3-dihydroxybutanedioic acid;bis((2R)-N,N,2-trimethyl-3-phenothiazin-10-ylpropan-1-amine).
| Compound Name | (2R,3R)-2,3-dihydroxybutanedioic acid;bis((2R)-N,N,2-trimethyl-3-phenothiazin-10-ylpropan-1-amine) |
|---|---|
| PubChem CID | 91827206 |
| Molecular Formula | C40H50N4O6S2 |
| Molecular Weight | 747.00 g/mol |
| Exact Mass | 746.32 |
| IUPAC Name | (2R,3R)-2,3-dihydroxybutanedioic acid;bis((2R)-N,N,2-trimethyl-3-phenothiazin-10-ylpropan-1-amine) |
| SMILES | C[C@H](CN(C)C)CN1c2ccccc2Sc2ccccc21.C[C@H](CN(C)C)CN1c2ccccc2Sc2ccccc21.O=C(O)[C@H](O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/2C18H22N2S.C4H6O6/c2*1-14(12-19(2)3)13-20-15-8-4-6-10-17(15)21-18-11-7-5-9-16(18)20;5-1(3(7)8)2(6)4(9)10/h2*4-11,14H,12-13H2,1-3H3;1-2,5-6H,(H,7,8)(H,9,10)/t2*14-;1-,2-/m111/s1 |
| InChIKey | AJZJIYUOOJLBAU-IPJKORRHSA-N |
| XLogP | 6.85 |
| TPSA | 128.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.00 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'} |
|---|