C21H26N2OS — CID 23276631
1-[10-[3-(dimethylamino)-2-methylpropyl]phenothiazin-2-yl]propan-1-one (PubChem CID 23276631) has the molecular formula C21H26N2OS and a molecular weight of 354.52 g/mol. Its IUPAC name is 1-[10-[3-(dimethylamino)-2-methylpropyl]phenothiazin-2-yl]propan-1-one.
| Compound Name | 1-[10-[3-(dimethylamino)-2-methylpropyl]phenothiazin-2-yl]propan-1-one |
|---|---|
| PubChem CID | 23276631 |
| Molecular Formula | C21H26N2OS |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 1-[10-[3-(dimethylamino)-2-methylpropyl]phenothiazin-2-yl]propan-1-one |
| SMILES | CCC(=O)c1ccc2c(c1)N(CC(C)CN(C)C)c1ccccc1S2 |
| InChI | InChI=1S/C21H26N2OS/c1-5-19(24)16-10-11-21-18(12-16)23(14-15(2)13-22(3)4)17-8-6-7-9-20(17)25-21/h6-12,15H,5,13-14H2,1-4H3 |
| InChIKey | HPXVGSNUHBYOGP-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |