C30H24N2O2S2 — CID 174190428
2-methylidene-4-phenothiazin-10-yl-3-(phenothiazin-10-ylmethyl)butanoic acid (PubChem CID 174190428) has the molecular formula C30H24N2O2S2 and a molecular weight of 508.67 g/mol. Its IUPAC name is 2-methylidene-4-phenothiazin-10-yl-3-(phenothiazin-10-ylmethyl)butanoic acid.
| Compound Name | 2-methylidene-4-phenothiazin-10-yl-3-(phenothiazin-10-ylmethyl)butanoic acid |
|---|---|
| PubChem CID | 174190428 |
| Molecular Formula | C30H24N2O2S2 |
| Molecular Weight | 508.67 g/mol |
| Exact Mass | 508.13 |
| IUPAC Name | 2-methylidene-4-phenothiazin-10-yl-3-(phenothiazin-10-ylmethyl)butanoic acid |
| SMILES | C=C(C(=O)O)C(CN1c2ccccc2Sc2ccccc21)CN1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C30H24N2O2S2/c1-20(30(33)34)21(18-31-22-10-2-6-14-26(22)35-27-15-7-3-11-23(27)31)19-32-24-12-4-8-16-28(24)36-29-17-9-5-13-25(29)32/h2-17,21H,1,18-19H2,(H,33,34) |
| InChIKey | GVARXHAMTKEZCW-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.67 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|