C21H18N4OS2 — CID 22302182
1-[(2-phenothiazin-10-ylacetyl)amino]-1-phenylthiourea (PubChem CID 22302182) has the molecular formula C21H18N4OS2 and a molecular weight of 406.54 g/mol. Its IUPAC name is 1-[(2-phenothiazin-10-ylacetyl)amino]-1-phenylthiourea.
| Compound Name | 1-[(2-phenothiazin-10-ylacetyl)amino]-1-phenylthiourea |
|---|---|
| PubChem CID | 22302182 |
| Molecular Formula | C21H18N4OS2 |
| Molecular Weight | 406.54 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 1-[(2-phenothiazin-10-ylacetyl)amino]-1-phenylthiourea |
| SMILES | NC(=S)N(NC(=O)CN1c2ccccc2Sc2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C21H18N4OS2/c22-21(27)25(15-8-2-1-3-9-15)23-20(26)14-24-16-10-4-6-12-18(16)28-19-13-7-5-11-17(19)24/h1-13H,14H2,(H2,22,27)(H,23,26) |
| InChIKey | ITPVGHPQVGXAKT-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.54 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|