C16H8F4NO3S- — CID 164746772
2,2,3,3-tetrafluoro-4-oxo-4-phenothiazin-10-ylbutanoate (PubChem CID 164746772) has the molecular formula C16H8F4NO3S- and a molecular weight of 370.30 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-4-oxo-4-phenothiazin-10-ylbutanoate.
| Compound Name | 2,2,3,3-tetrafluoro-4-oxo-4-phenothiazin-10-ylbutanoate |
|---|---|
| PubChem CID | 164746772 |
| Molecular Formula | C16H8F4NO3S- |
| Molecular Weight | 370.30 g/mol |
| Exact Mass | 370.02 |
| IUPAC Name | 2,2,3,3-tetrafluoro-4-oxo-4-phenothiazin-10-ylbutanoate |
| SMILES | O=C([O-])C(F)(F)C(F)(F)C(=O)N1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C16H9F4NO3S/c17-15(18,16(19,20)14(23)24)13(22)21-9-5-1-3-7-11(9)25-12-8-4-2-6-10(12)21/h1-8H,(H,23,24)/p-1 |
| InChIKey | GOIGMMLVGFFCOK-UHFFFAOYSA-M |
| XLogP | 2.84 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.30 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|