C25H31N2O+ — CID 6913238
5-methoxy-2,3,3-trimethyl-1-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]-2H-indol-1-ium (PubChem CID 6913238) has the molecular formula C25H31N2O+ and a molecular weight of 375.54 g/mol. Its IUPAC name is 5-methoxy-2,3,3-trimethyl-1-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]-2H-indol-1-ium.
| Compound Name | 5-methoxy-2,3,3-trimethyl-1-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]-2H-indol-1-ium |
|---|---|
| PubChem CID | 6913238 |
| Molecular Formula | C25H31N2O+ |
| Molecular Weight | 375.54 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | 5-methoxy-2,3,3-trimethyl-1-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]-2H-indol-1-ium |
| SMILES | COc1ccc2c(c1)C(C)(C)C(C)/[N+]2=C\C=C1/N(C)c2ccccc2C1(C)C |
| InChI | InChI=1S/C25H31N2O/c1-17-24(2,3)20-16-18(28-7)12-13-22(20)27(17)15-14-23-25(4,5)19-10-8-9-11-21(19)26(23)6/h8-17H,1-7H3/q+1 |
| InChIKey | NGDUUCNDIVNLHQ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 15.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.54 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|