C28H34N2O2 — CID 59061578
2-(1,2,3,4,4a,9a-hexahydrocarbazol-9-yl)-4-[(1,3,3-trimethylindol-2-ylidene)methyl]cyclobutane-1,3-diol (PubChem CID 59061578) has the molecular formula C28H34N2O2 and a molecular weight of 430.59 g/mol. Its IUPAC name is 2-(1,2,3,4,4a,9a-hexahydrocarbazol-9-yl)-4-[(1,3,3-trimethylindol-2-ylidene)methyl]cyclobutane-1,3-diol.
| Compound Name | 2-(1,2,3,4,4a,9a-hexahydrocarbazol-9-yl)-4-[(1,3,3-trimethylindol-2-ylidene)methyl]cyclobutane-1,3-diol |
|---|---|
| PubChem CID | 59061578 |
| Molecular Formula | C28H34N2O2 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | 2-(1,2,3,4,4a,9a-hexahydrocarbazol-9-yl)-4-[(1,3,3-trimethylindol-2-ylidene)methyl]cyclobutane-1,3-diol |
| SMILES | CN1C(=CC2C(O)C(N3c4ccccc4C4CCCCC43)C2O)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C28H34N2O2/c1-28(2)20-12-6-9-15-23(20)29(3)24(28)16-19-26(31)25(27(19)32)30-21-13-7-4-10-17(21)18-11-5-8-14-22(18)30/h4,6-7,9-10,12-13,15-16,18-19,22,25-27,31-32H,5,8,11,14H2,1-3H3 |
| InChIKey | NORJBJBKBSMBEA-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |