C19H26N2O — CID 4656730
N-cyclohexyl-2-(1,3,3-trimethylindol-2-ylidene)acetamide (PubChem CID 4656730) has the molecular formula C19H26N2O and a molecular weight of 298.43 g/mol. Its IUPAC name is N-cyclohexyl-2-(1,3,3-trimethylindol-2-ylidene)acetamide.
| Compound Name | N-cyclohexyl-2-(1,3,3-trimethylindol-2-ylidene)acetamide |
|---|---|
| PubChem CID | 4656730 |
| Molecular Formula | C19H26N2O |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | N-cyclohexyl-2-(1,3,3-trimethylindol-2-ylidene)acetamide |
| SMILES | CN1C(=CC(=O)NC2CCCCC2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C19H26N2O/c1-19(2)15-11-7-8-12-16(15)21(3)17(19)13-18(22)20-14-9-5-4-6-10-14/h7-8,11-14H,4-6,9-10H2,1-3H3,(H,20,22) |
| InChIKey | QEBUWCDDZZSVLF-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|