C17H22N2OS — CID 4255167
2-methyl-N-[2-(1,3,3-trimethylindol-2-ylidene)ethanethioyl]propanamide (PubChem CID 4255167) has the molecular formula C17H22N2OS and a molecular weight of 302.44 g/mol. Its IUPAC name is 2-methyl-N-[2-(1,3,3-trimethylindol-2-ylidene)ethanethioyl]propanamide.
| Compound Name | 2-methyl-N-[2-(1,3,3-trimethylindol-2-ylidene)ethanethioyl]propanamide |
|---|---|
| PubChem CID | 4255167 |
| Molecular Formula | C17H22N2OS |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 2-methyl-N-[2-(1,3,3-trimethylindol-2-ylidene)ethanethioyl]propanamide |
| SMILES | CC(C)C(=O)NC(=S)C=C1N(C)c2ccccc2C1(C)C |
| InChI | InChI=1S/C17H22N2OS/c1-11(2)16(20)18-15(21)10-14-17(3,4)12-8-6-7-9-13(12)19(14)5/h6-11H,1-5H3,(H,18,20,21) |
| InChIKey | VRHNANJHHIYHQJ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|