C32H28ClN3O4 — CID 57376805
2-[2-(1,2-diphenylindol-3-yl)ethenyl]-1,3,3-trimethylpyrrolo[2,3-b]pyridin-1-ium perchlorate (PubChem CID 57376805) has the molecular formula C32H28ClN3O4 and a molecular weight of 554.05 g/mol. Its IUPAC name is 2-[2-(1,2-diphenylindol-3-yl)ethenyl]-1,3,3-trimethylpyrrolo[2,3-b]pyridin-1-ium perchlorate.
| Compound Name | 2-[2-(1,2-diphenylindol-3-yl)ethenyl]-1,3,3-trimethylpyrrolo[2,3-b]pyridin-1-ium perchlorate |
|---|---|
| PubChem CID | 57376805 |
| Molecular Formula | C32H28ClN3O4 |
| Molecular Weight | 554.05 g/mol |
| Exact Mass | 553.18 |
| IUPAC Name | 2-[2-(1,2-diphenylindol-3-yl)ethenyl]-1,3,3-trimethylpyrrolo[2,3-b]pyridin-1-ium perchlorate |
| SMILES | C[N+]1=C(C=Cc2c(-c3ccccc3)n(-c3ccccc3)c3ccccc23)C(C)(C)c2cccnc21.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C32H28N3.ClHO4/c1-32(2)27-18-12-22-33-31(27)34(3)29(32)21-20-26-25-17-10-11-19-28(25)35(24-15-8-5-9-16-24)30(26)23-13-6-4-7-14-23;2-1(3,4)5/h4-22H,1-3H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | ZPMURFGDZAMKLO-UHFFFAOYSA-M |
| XLogP | 2.66 |
| TPSA | 113.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.05 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|