C37H30ClNO5 — CID 73449331
2-[2-(2,4-diphenylindeno[2,3-b]pyran-9-yl)ethenyl]-1,3,3-trimethylindol-1-ium perchlorate (PubChem CID 73449331) has the molecular formula C37H30ClNO5 and a molecular weight of 604.10 g/mol. Its IUPAC name is 2-[2-(2,4-diphenylindeno[2,3-b]pyran-9-yl)ethenyl]-1,3,3-trimethylindol-1-ium perchlorate.
| Compound Name | 2-[2-(2,4-diphenylindeno[2,3-b]pyran-9-yl)ethenyl]-1,3,3-trimethylindol-1-ium perchlorate |
|---|---|
| PubChem CID | 73449331 |
| Molecular Formula | C37H30ClNO5 |
| Molecular Weight | 604.10 g/mol |
| Exact Mass | 603.18 |
| IUPAC Name | 2-[2-(2,4-diphenylindeno[2,3-b]pyran-9-yl)ethenyl]-1,3,3-trimethylindol-1-ium perchlorate |
| SMILES | C[N+]1=C(C=Cc2c3oc(-c4ccccc4)cc(-c4ccccc4)c-3c3ccccc23)C(C)(C)c2ccccc21.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C37H30NO.ClHO4/c1-37(2)31-20-12-13-21-32(31)38(3)34(37)23-22-29-27-18-10-11-19-28(27)35-30(25-14-6-4-7-15-25)24-33(39-36(29)35)26-16-8-5-9-17-26;2-1(3,4)5/h4-24H,1-3H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | KFFPMBAWBLQXEF-UHFFFAOYSA-M |
| XLogP | 4.84 |
| TPSA | 108.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.10 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|