C26H27N2OS+ — CID 177489140
2-[(E)-2-(dimethylamino)ethenyl]-3-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]chromene-4-thione (PubChem CID 177489140) has the molecular formula C26H27N2OS+ and a molecular weight of 415.58 g/mol. Its IUPAC name is 2-[(E)-2-(dimethylamino)ethenyl]-3-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]chromene-4-thione.
| Compound Name | 2-[(E)-2-(dimethylamino)ethenyl]-3-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]chromene-4-thione |
|---|---|
| PubChem CID | 177489140 |
| Molecular Formula | C26H27N2OS+ |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 2-[(E)-2-(dimethylamino)ethenyl]-3-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]chromene-4-thione |
| SMILES | CN(C)/C=C/c1oc2ccccc2c(=S)c1/C=C/C1=[N+](C)c2ccccc2C1(C)C |
| InChI | InChI=1S/C26H27N2OS/c1-26(2)20-11-7-8-12-21(20)28(5)24(26)15-14-19-23(16-17-27(3)4)29-22-13-9-6-10-18(22)25(19)30/h6-17H,1-5H3/q+1 |
| InChIKey | ISBWNLGORWMAFK-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 19.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|