C26H26IN3 — CID 175352623
1,9-dimethyl-3-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]pyrido[3,4-b]indole iodide (PubChem CID 175352623) has the molecular formula C26H26IN3 and a molecular weight of 507.42 g/mol. Its IUPAC name is 1,9-dimethyl-3-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]pyrido[3,4-b]indole iodide.
| Compound Name | 1,9-dimethyl-3-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]pyrido[3,4-b]indole iodide |
|---|---|
| PubChem CID | 175352623 |
| Molecular Formula | C26H26IN3 |
| Molecular Weight | 507.42 g/mol |
| Exact Mass | 507.12 |
| IUPAC Name | 1,9-dimethyl-3-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]pyrido[3,4-b]indole iodide |
| SMILES | Cc1nc(/C=C/C2=[N+](C)c3ccccc3C2(C)C)cc2c3ccccc3n(C)c12.[I-] |
| InChI | InChI=1S/C26H26N3.HI/c1-17-25-20(19-10-6-8-12-22(19)29(25)5)16-18(27-17)14-15-24-26(2,3)21-11-7-9-13-23(21)28(24)4;/h6-16H,1-5H3;1H/q+1;/p-1 |
| InChIKey | AIPJDOXYXZXFSA-UHFFFAOYSA-M |
| XLogP | 2.76 |
| TPSA | 20.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.42 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|