C24H25N2O2+ — CID 46499643
methyl 1,3,3-trimethyl-2-[(E)-2-(2-methyl-1H-indol-3-yl)ethenyl]indol-1-ium-5-carboxylate (PubChem CID 46499643) has the molecular formula C24H25N2O2+ and a molecular weight of 373.48 g/mol. Its IUPAC name is methyl 1,3,3-trimethyl-2-[(E)-2-(2-methyl-1H-indol-3-yl)ethenyl]indol-1-ium-5-carboxylate.
| Compound Name | methyl 1,3,3-trimethyl-2-[(E)-2-(2-methyl-1H-indol-3-yl)ethenyl]indol-1-ium-5-carboxylate |
|---|---|
| PubChem CID | 46499643 |
| Molecular Formula | C24H25N2O2+ |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | methyl 1,3,3-trimethyl-2-[(E)-2-(2-methyl-1H-indol-3-yl)ethenyl]indol-1-ium-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)C(C)(C)C(/C=C/c1c(C)[nH]c3ccccc13)=[N+]2C |
| InChI | InChI=1S/C24H24N2O2/c1-15-17(18-8-6-7-9-20(18)25-15)11-13-22-24(2,3)19-14-16(23(27)28-5)10-12-21(19)26(22)4/h6-14H,1-5H3/p+1 |
| InChIKey | CNANZYWKSUIRCE-UHFFFAOYSA-O |
| XLogP | 4.98 |
| TPSA | 45.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|