C44H46N4O4S — CID 21117037
bis(1,3,3-trimethyl-2-[(E)-2-(2-methyl-3H-indol-3-yl)ethenyl]indol-1-ium);sulfate (PubChem CID 21117037) has the molecular formula C44H46N4O4S and a molecular weight of 726.94 g/mol. Its IUPAC name is bis(1,3,3-trimethyl-2-[(E)-2-(2-methyl-3H-indol-3-yl)ethenyl]indol-1-ium);sulfate.
| Compound Name | bis(1,3,3-trimethyl-2-[(E)-2-(2-methyl-3H-indol-3-yl)ethenyl]indol-1-ium);sulfate |
|---|---|
| PubChem CID | 21117037 |
| Molecular Formula | C44H46N4O4S |
| Molecular Weight | 726.94 g/mol |
| Exact Mass | 726.32 |
| IUPAC Name | bis(1,3,3-trimethyl-2-[(E)-2-(2-methyl-3H-indol-3-yl)ethenyl]indol-1-ium);sulfate |
| SMILES | CC1=Nc2ccccc2C1/C=C/C1=[N+](C)c2ccccc2C1(C)C.CC1=Nc2ccccc2C1/C=C/C1=[N+](C)c2ccccc2C1(C)C.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/2C22H23N2.H2O4S/c2*1-15-16(17-9-5-7-11-19(17)23-15)13-14-21-22(2,3)18-10-6-8-12-20(18)24(21)4;1-5(2,3)4/h2*5-14,16H,1-4H3;(H2,1,2,3,4)/q2*+1;/p-2/b2*14-13+; |
| InChIKey | OTDAXDIMRNJAFQ-FZHLCEHXSA-L |
| XLogP | 8.94 |
| TPSA | 111.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.94 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|