C26H39N3S+2 — CID 88937018
6-[1-methyl-4-[4-[(E)-2-(1-methylpyridin-1-ium-2-yl)ethenyl]phenyl]-1,4-diazepan-1-ium-1-yl]hexane-1-thiol (PubChem CID 88937018) has the molecular formula C26H39N3S+2 and a molecular weight of 425.69 g/mol. Its IUPAC name is 6-[1-methyl-4-[4-[(E)-2-(1-methylpyridin-1-ium-2-yl)ethenyl]phenyl]-1,4-diazepan-1-ium-1-yl]hexane-1-thiol.
| Compound Name | 6-[1-methyl-4-[4-[(E)-2-(1-methylpyridin-1-ium-2-yl)ethenyl]phenyl]-1,4-diazepan-1-ium-1-yl]hexane-1-thiol |
|---|---|
| PubChem CID | 88937018 |
| Molecular Formula | C26H39N3S+2 |
| Molecular Weight | 425.69 g/mol |
| Exact Mass | 425.29 |
| IUPAC Name | 6-[1-methyl-4-[4-[(E)-2-(1-methylpyridin-1-ium-2-yl)ethenyl]phenyl]-1,4-diazepan-1-ium-1-yl]hexane-1-thiol |
| SMILES | C[n+]1ccccc1/C=C/c1ccc(N2CCC[N+](C)(CCCCCCS)CC2)cc1 |
| InChI | InChI=1S/C26H38N3S/c1-27-17-6-5-10-25(27)14-11-24-12-15-26(16-13-24)28-18-9-21-29(2,22-19-28)20-7-3-4-8-23-30/h5-6,10-17H,3-4,7-9,18-23H2,1-2H3/q+1/p+1 |
| InChIKey | NKQFTDAOGFDNLL-UHFFFAOYSA-O |
| XLogP | 4.83 |
| TPSA | 7.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.69 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|