C31H43N5S+2 — CID 88937013
1,3-dimethyl-2-[2-[1-methyl-4-[4-[(E)-2-(1-methyl-3,4-dihydro-2H-pyridin-4-yl)ethenyl]phenyl]-1,4-diazepan-1-ium-1-yl]ethylsulfanyl]benzimidazol-3-ium (PubChem CID 88937013) has the molecular formula C31H43N5S+2 and a molecular weight of 517.79 g/mol. Its IUPAC name is 1,3-dimethyl-2-[2-[1-methyl-4-[4-[(E)-2-(1-methyl-3,4-dihydro-2H-pyridin-4-yl)ethenyl]phenyl]-1,4-diazepan-1-ium-1-yl]ethylsulfanyl]benzimidazol-3-ium.
| Compound Name | 1,3-dimethyl-2-[2-[1-methyl-4-[4-[(E)-2-(1-methyl-3,4-dihydro-2H-pyridin-4-yl)ethenyl]phenyl]-1,4-diazepan-1-ium-1-yl]ethylsulfanyl]benzimidazol-3-ium |
|---|---|
| PubChem CID | 88937013 |
| Molecular Formula | C31H43N5S+2 |
| Molecular Weight | 517.79 g/mol |
| Exact Mass | 517.32 |
| IUPAC Name | 1,3-dimethyl-2-[2-[1-methyl-4-[4-[(E)-2-(1-methyl-3,4-dihydro-2H-pyridin-4-yl)ethenyl]phenyl]-1,4-diazepan-1-ium-1-yl]ethylsulfanyl]benzimidazol-3-ium |
| SMILES | CN1C=CC(/C=C/c2ccc(N3CCC[N+](C)(CCSc4n(C)c5ccccc5[n+]4C)CC3)cc2)CC1 |
| InChI | InChI=1S/C31H43N5S/c1-32-19-16-27(17-20-32)11-10-26-12-14-28(15-13-26)35-18-7-22-36(4,23-21-35)24-25-37-31-33(2)29-8-5-6-9-30(29)34(31)3/h5-6,8-16,19,27H,7,17-18,20-25H2,1-4H3/q+2/b11-10+ |
| InChIKey | TWHVKEYYVZLXPE-ZHACJKMWSA-N |
| XLogP | 4.93 |
| TPSA | 15.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.79 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|