About 1-dodecyl-2-ethenylpyridin-1-ium;trihydrobromide
1-dodecyl-2-ethenylpyridin-1-ium;trihydrobromide (PubChem CID 174628821) has the molecular formula C19H35Br3N+
and a molecular weight of 517.21 g/mol. Its IUPAC name is 1-dodecyl-2-ethenylpyridin-1-ium;trihydrobromide.
Molecular Properties
| Compound Name | 1-dodecyl-2-ethenylpyridin-1-ium;trihydrobromide |
| PubChem CID | 174628821 |
| Molecular Formula | C19H35Br3N+ |
| Molecular Weight | 517.21 g/mol |
| Exact Mass | 514.03 |
| IUPAC Name | 1-dodecyl-2-ethenylpyridin-1-ium;trihydrobromide |
| SMILES | Br.Br.Br.C=Cc1cccc[n+]1CCCCCCCCCCCC |
| InChI | InChI=1S/C19H32N.3BrH/c1-3-5-6-7-8-9-10-11-12-14-17-20-18-15-13-16-19(20)4-2;;;/h4,13,15-16,18H,2-3,5-12,14,17H2,1H3;3*1H/q+1;;; |
| InChIKey | ZEBYPFHALYAGLQ-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 517.21 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-dodecyl-2-ethenylpyridin-1-ium;trihydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-dodecyl-2-ethenylpyridin-1-ium;trihydrobromide?
The IUPAC name of 1-dodecyl-2-ethenylpyridin-1-ium;trihydrobromide (CID 174628821) is 1-dodecyl-2-ethenylpyridin-1-ium;trihydrobromide.
What is the SMILES notation for 1-dodecyl-2-ethenylpyridin-1-ium;trihydrobromide?
The canonical SMILES for 1-dodecyl-2-ethenylpyridin-1-ium;trihydrobromide is Br.Br.Br.C=Cc1cccc[n+]1CCCCCCCCCCCC.
What is the InChIKey of 1-dodecyl-2-ethenylpyridin-1-ium;trihydrobromide?
The InChIKey is ZEBYPFHALYAGLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H32N.3BrH/c1-3-5-6-7-8-9-10-11-12-14-17-20-18-15-13-16-19(20)4-2;;;/h4,13,15-16,18H,2-3,5-12,14,17H2,1H3;3*1H/q+1;;;.
What are the key properties of 1-dodecyl-2-ethenylpyridin-1-ium;trihydrobromide?
1-dodecyl-2-ethenylpyridin-1-ium;trihydrobromide has a molecular weight of 517.21 g/mol, XLogP of 7.27, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-dodecyl-2-ethenylpyridin-1-ium;trihydrobromide is sourced from PubChem (CID 174628821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).