C29H36NO2+ — CID 100917341
2-ethenyl-1-[9-[4-(4-methoxyphenyl)phenoxy]nonyl]pyridin-1-ium (PubChem CID 100917341) has the molecular formula C29H36NO2+ and a molecular weight of 430.61 g/mol. Its IUPAC name is 2-ethenyl-1-[9-[4-(4-methoxyphenyl)phenoxy]nonyl]pyridin-1-ium.
| Compound Name | 2-ethenyl-1-[9-[4-(4-methoxyphenyl)phenoxy]nonyl]pyridin-1-ium |
|---|---|
| PubChem CID | 100917341 |
| Molecular Formula | C29H36NO2+ |
| Molecular Weight | 430.61 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | 2-ethenyl-1-[9-[4-(4-methoxyphenyl)phenoxy]nonyl]pyridin-1-ium |
| SMILES | C=Cc1cccc[n+]1CCCCCCCCCOc1ccc(-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C29H36NO2/c1-3-27-13-9-11-23-30(27)22-10-7-5-4-6-8-12-24-32-29-20-16-26(17-21-29)25-14-18-28(31-2)19-15-25/h3,9,11,13-21,23H,1,4-8,10,12,22,24H2,2H3/q+1 |
| InChIKey | SDZTUXFHQUBEHN-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.61 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|